C16H24O6 — CID 134845235
(3'aR,6R,6'aR)-5'-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole] (PubChem CID 134845235) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (3'aR,6R,6'aR)-5'-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole].
| Compound Name | (3'aR,6R,6'aR)-5'-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole] |
|---|---|
| PubChem CID | 134845235 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3'aR,6R,6'aR)-5'-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole] |
| SMILES | CC1(C)OC[C@H](C2O[C@@H]3OC(C)(C)O[C@@H]3[C@@]23CC=CCO3)O1 |
| InChI | InChI=1S/C16H24O6/c1-14(2)18-9-10(20-14)11-16(7-5-6-8-17-16)12-13(19-11)22-15(3,4)21-12/h5-6,10-13H,7-9H2,1-4H3/t10-,11?,12+,13-,16-/m1/s1 |
| InChIKey | RJBWXGKIRLPVBA-VYPUVKRYSA-N |
| XLogP | 1.73 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|