C16H24O5 — CID 134831175
(6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,4'-cyclopentene] (PubChem CID 134831175) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,4'-cyclopentene].
| Compound Name | (6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,4'-cyclopentene] |
|---|---|
| PubChem CID | 134831175 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,4'-cyclopentene] |
| SMILES | CC1(C)OCC(C2OC3OC(C)(C)O[C@H]3C23CC=CC3)O1 |
| InChI | InChI=1S/C16H24O5/c1-14(2)17-9-10(19-14)11-16(7-5-6-8-16)12-13(18-11)21-15(3,4)20-12/h5-6,10-13H,7-9H2,1-4H3/t10?,11?,12-,13?/m1/s1 |
| InChIKey | VAQVXROAWYJEEB-AYNROABZSA-N |
| XLogP | 2.35 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|