C27H34O9 — CID 50942028
(E)-3-(4-propan-2-ylphenyl)-1-[2,4,6-trimethoxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]prop-2-en-1-one (PubChem CID 50942028) has the molecular formula C27H34O9 and a molecular weight of 502.56 g/mol. Its IUPAC name is (E)-3-(4-propan-2-ylphenyl)-1-[2,4,6-trimethoxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-propan-2-ylphenyl)-1-[2,4,6-trimethoxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 50942028 |
| Molecular Formula | C27H34O9 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | (E)-3-(4-propan-2-ylphenyl)-1-[2,4,6-trimethoxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]prop-2-en-1-one |
| SMILES | COc1cc(OC)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1C(=O)/C=C/c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H34O9/c1-14(2)16-9-6-15(7-10-16)8-11-17(29)21-18(33-3)12-19(34-4)22(26(21)35-5)27-25(32)24(31)23(30)20(13-28)36-27/h6-12,14,20,23-25,27-28,30-32H,13H2,1-5H3/b11-8+/t20-,23-,24+,25-,27+/m1/s1 |
| InChIKey | XWFOTDNBYMMFJA-WHAZABQWSA-N |
| XLogP | 2.25 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|