C33H33N2O3+ — CID 50942082
1-benzyl-2-(4-methoxyphenyl)-3-methyl-4-(3-methylphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 50942082) has the molecular formula C33H33N2O3+ and a molecular weight of 505.64 g/mol. Its IUPAC name is 1-benzyl-2-(4-methoxyphenyl)-3-methyl-4-(3-methylphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylic acid.
| Compound Name | 1-benzyl-2-(4-methoxyphenyl)-3-methyl-4-(3-methylphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 50942082 |
| Molecular Formula | C33H33N2O3+ |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 1-benzyl-2-(4-methoxyphenyl)-3-methyl-4-(3-methylphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | COc1ccc(C2=[N+](C)C(c3cccc(C)c3)C(C(=O)O)(c3ccc(C)cc3)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H32N2O3/c1-23-13-17-28(18-14-23)33(32(36)37)30(27-12-8-9-24(2)21-27)34(3)31(26-15-19-29(38-4)20-16-26)35(33)22-25-10-6-5-7-11-25/h5-21,30H,22H2,1-4H3/p+1 |
| InChIKey | MUXUKBMTKTVYCM-UHFFFAOYSA-O |
| XLogP | 5.94 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|