C38H35N2O2+ — CID 50941791
(4R,5R)-1,3-dibenzyl-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 50941791) has the molecular formula C38H35N2O2+ and a molecular weight of 551.71 g/mol. Its IUPAC name is (4R,5R)-1,3-dibenzyl-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid.
| Compound Name | (4R,5R)-1,3-dibenzyl-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 50941791 |
| Molecular Formula | C38H35N2O2+ |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | (4R,5R)-1,3-dibenzyl-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | Cc1ccc([C@H]2[N+](Cc3ccccc3)=C(c3ccccc3)N(Cc3ccccc3)[C@]2(C(=O)O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C38H34N2O2/c1-28-18-22-32(23-19-28)35-38(37(41)42,34-24-20-29(2)21-25-34)40(27-31-14-8-4-9-15-31)36(33-16-10-5-11-17-33)39(35)26-30-12-6-3-7-13-30/h3-25,35H,26-27H2,1-2H3/p+1/t35-,38-/m1/s1 |
| InChIKey | HJYKCMBINXZDAK-FOYYQAIFSA-O |
| XLogP | 7.50 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|