C29H24N2O2S — CID 50942168
2-benzyl-1-phenyl-3-thiophen-2-yl-6,10b-dihydro-5H-imidazo[5,1-a]isoquinolin-4-ium-1-carboxylate (PubChem CID 50942168) has the molecular formula C29H24N2O2S and a molecular weight of 464.59 g/mol. Its IUPAC name is 2-benzyl-1-phenyl-3-thiophen-2-yl-6,10b-dihydro-5H-imidazo[5,1-a]isoquinolin-4-ium-1-carboxylate.
| Compound Name | 2-benzyl-1-phenyl-3-thiophen-2-yl-6,10b-dihydro-5H-imidazo[5,1-a]isoquinolin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 50942168 |
| Molecular Formula | C29H24N2O2S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-benzyl-1-phenyl-3-thiophen-2-yl-6,10b-dihydro-5H-imidazo[5,1-a]isoquinolin-4-ium-1-carboxylate |
| SMILES | O=C([O-])C1(c2ccccc2)C2c3ccccc3CC[N+]2=C(c2cccs2)N1Cc1ccccc1 |
| InChI | InChI=1S/C29H24N2O2S/c32-28(33)29(23-13-5-2-6-14-23)26-24-15-8-7-12-22(24)17-18-30(26)27(25-16-9-19-34-25)31(29)20-21-10-3-1-4-11-21/h1-16,19,26H,17-18,20H2 |
| InChIKey | DQWBZNWBVJIQRW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|