About 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate
1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate (PubChem CID 56599813) has the molecular formula C28H30N2O2S2
and a molecular weight of 490.69 g/mol. Its IUPAC name is 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate.
Molecular Properties
| Compound Name | 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
| PubChem CID | 56599813 |
| Molecular Formula | C28H30N2O2S2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
| SMILES | CCN1C(c2ccccc2)=[N+](CC)C(c2ccc(SC)cc2)C1(C(=O)[O-])c1ccc(SC)cc1 |
| InChI | InChI=1S/C28H30N2O2S2/c1-5-29-25(20-12-16-23(33-3)17-13-20)28(27(31)32,22-14-18-24(34-4)19-15-22)30(6-2)26(29)21-10-8-7-9-11-21/h7-19,25H,5-6H2,1-4H3 |
| InChIKey | GZMCGGKKQMSGQL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate?
The IUPAC name of 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate (CID 56599813) is 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate.
What is the SMILES notation for 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate?
The canonical SMILES for 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate is CCN1C(c2ccccc2)=[N+](CC)C(c2ccc(SC)cc2)C1(C(=O)[O-])c1ccc(SC)cc1.
What is the InChIKey of 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate?
The InChIKey is GZMCGGKKQMSGQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N2O2S2/c1-5-29-25(20-12-16-23(33-3)17-13-20)28(27(31)32,22-14-18-24(34-4)19-15-22)30(6-2)26(29)21-10-8-7-9-11-21/h7-19,25H,5-6H2,1-4H3.
What are the key properties of 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate?
1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate has a molecular weight of 490.69 g/mol, XLogP of 4.63, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate is sourced from PubChem (CID 56599813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).