C30H26N2O2 — CID 25231639
methyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate (PubChem CID 25231639) has the molecular formula C30H26N2O2 and a molecular weight of 446.55 g/mol. Its IUPAC name is methyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate.
| Compound Name | methyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 25231639 |
| Molecular Formula | C30H26N2O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | methyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H26N2O2/c1-34-29(33)30(26-20-12-5-13-21-26)27(24-16-8-3-9-17-24)32(22-23-14-6-2-7-15-23)28(31-30)25-18-10-4-11-19-25/h2-21,27H,22H2,1H3/t27-,30-/m1/s1 |
| InChIKey | QZSHRWUWIWPXJR-POURPWNDSA-N |
| XLogP | 5.76 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |