C38H34N2O2S2 — CID 75587050
1,3-dibenzyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate (PubChem CID 75587050) has the molecular formula C38H34N2O2S2 and a molecular weight of 614.84 g/mol. Its IUPAC name is 1,3-dibenzyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 1,3-dibenzyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 75587050 |
| Molecular Formula | C38H34N2O2S2 |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | 1,3-dibenzyl-4,5-bis(4-methylsulfanylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
| SMILES | CSc1ccc(C2[N+](Cc3ccccc3)=C(c3ccccc3)N(Cc3ccccc3)C2(C(=O)[O-])c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C38H34N2O2S2/c1-43-33-22-18-30(19-23-33)35-38(37(41)42,32-20-24-34(44-2)25-21-32)40(27-29-14-8-4-9-15-29)36(31-16-10-5-11-17-31)39(35)26-28-12-6-3-7-13-28/h3-25,35H,26-27H2,1-2H3 |
| InChIKey | LERHOUJIKNCEDJ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|