C33H32N2O2 — CID 101128793
1,3-dibenzyl-2-methyl-4,5-bis(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate (PubChem CID 101128793) has the molecular formula C33H32N2O2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 1,3-dibenzyl-2-methyl-4,5-bis(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 1,3-dibenzyl-2-methyl-4,5-bis(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 101128793 |
| Molecular Formula | C33H32N2O2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 1,3-dibenzyl-2-methyl-4,5-bis(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
| SMILES | CC1=[N+](Cc2ccccc2)C(c2ccc(C)cc2)C(C(=O)[O-])(c2ccc(C)cc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H32N2O2/c1-24-14-18-29(19-15-24)31-33(32(36)37,30-20-16-25(2)17-21-30)35(23-28-12-8-5-9-13-28)26(3)34(31)22-27-10-6-4-7-11-27/h4-21,31H,22-23H2,1-3H3 |
| InChIKey | OCMIGRWWEGGOFM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|