C32H30N2O2 — CID 44591543
propan-2-yl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate (PubChem CID 44591543) has the molecular formula C32H30N2O2 and a molecular weight of 474.60 g/mol. Its IUPAC name is propan-2-yl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate.
| Compound Name | propan-2-yl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 44591543 |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | propan-2-yl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
| SMILES | CC(C)OC(=O)[C@]1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H30N2O2/c1-24(2)36-31(35)32(28-21-13-6-14-22-28)29(26-17-9-4-10-18-26)34(23-25-15-7-3-8-16-25)30(33-32)27-19-11-5-12-20-27/h3-22,24,29H,23H2,1-2H3/t29-,32-/m1/s1 |
| InChIKey | WPCSQWOAEHRTGB-QLWXXVCSSA-N |
| XLogP | 6.54 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |