C26H26N2O2 — CID 101128795
1,3-dimethyl-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate (PubChem CID 101128795) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1,3-dimethyl-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 1,3-dimethyl-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 101128795 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1,3-dimethyl-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
| SMILES | Cc1ccc(C2[N+](C)=C(c3ccccc3)N(C)C2(C(=O)[O-])c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H26N2O2/c1-18-10-14-20(15-11-18)23-26(25(29)30,22-16-12-19(2)13-17-22)28(4)24(27(23)3)21-8-6-5-7-9-21/h5-17,23H,1-4H3 |
| InChIKey | PFRVMPNULCIJTO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|