C30H34N2O4 — CID 101128797
1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate (PubChem CID 101128797) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 101128797 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylate |
| SMILES | COCCN1C(c2ccccc2)=[N+](CCOC)C(c2ccc(C)cc2)C1(C(=O)[O-])c1ccc(C)cc1 |
| InChI | InChI=1S/C30H34N2O4/c1-22-10-14-24(15-11-22)27-30(29(33)34,26-16-12-23(2)13-17-26)32(19-21-36-4)28(31(27)18-20-35-3)25-8-6-5-7-9-25/h5-17,27H,18-21H2,1-4H3 |
| InChIKey | KWUKSVIVXVFFLS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|