C36H33N2O2S+ — CID 50941891
(4R,5R)-1,3-dibenzyl-4,5-bis(4-methylphenyl)-2-thiophen-2-yl-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 50941891) has the molecular formula C36H33N2O2S+ and a molecular weight of 557.74 g/mol. Its IUPAC name is (4R,5R)-1,3-dibenzyl-4,5-bis(4-methylphenyl)-2-thiophen-2-yl-4H-imidazol-3-ium-5-carboxylic acid.
| Compound Name | (4R,5R)-1,3-dibenzyl-4,5-bis(4-methylphenyl)-2-thiophen-2-yl-4H-imidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 50941891 |
| Molecular Formula | C36H33N2O2S+ |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | (4R,5R)-1,3-dibenzyl-4,5-bis(4-methylphenyl)-2-thiophen-2-yl-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | Cc1ccc([C@H]2[N+](Cc3ccccc3)=C(c3cccs3)N(Cc3ccccc3)[C@]2(C(=O)O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H32N2O2S/c1-26-15-19-30(20-16-26)33-36(35(39)40,31-21-17-27(2)18-22-31)38(25-29-12-7-4-8-13-29)34(32-14-9-23-41-32)37(33)24-28-10-5-3-6-11-28/h3-23,33H,24-25H2,1-2H3/p+1/t33-,36-/m1/s1 |
| InChIKey | SANBYDWAALOICF-YYFXGUOYSA-O |
| XLogP | 7.56 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|