C33H31N2O2S+ — CID 50941989
1-benzyl-5-(4-methylsulfanylphenyl)-2,4-diphenyl-3-prop-2-enyl-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 50941989) has the molecular formula C33H31N2O2S+ and a molecular weight of 519.69 g/mol. Its IUPAC name is 1-benzyl-5-(4-methylsulfanylphenyl)-2,4-diphenyl-3-prop-2-enyl-4H-imidazol-3-ium-5-carboxylic acid.
| Compound Name | 1-benzyl-5-(4-methylsulfanylphenyl)-2,4-diphenyl-3-prop-2-enyl-4H-imidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 50941989 |
| Molecular Formula | C33H31N2O2S+ |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 1-benzyl-5-(4-methylsulfanylphenyl)-2,4-diphenyl-3-prop-2-enyl-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | C=CC[N+]1=C(c2ccccc2)N(Cc2ccccc2)C(C(=O)O)(c2ccc(SC)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C33H30N2O2S/c1-3-23-34-30(26-15-9-5-10-16-26)33(32(36)37,28-19-21-29(38-2)22-20-28)35(24-25-13-7-4-8-14-25)31(34)27-17-11-6-12-18-27/h3-22,30H,1,23-24H2,2H3/p+1 |
| InChIKey | JSBFHEZJJYMIEE-UHFFFAOYSA-O |
| XLogP | 6.59 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|