C29H25ClN2O2 — CID 44563948
(4R,5R)-3-benzyl-2,4,5-triphenyl-1,4-dihydroimidazol-3-ium-5-carboxylic acid chloride (PubChem CID 44563948) has the molecular formula C29H25ClN2O2 and a molecular weight of 468.98 g/mol. Its IUPAC name is (4R,5R)-3-benzyl-2,4,5-triphenyl-1,4-dihydroimidazol-3-ium-5-carboxylic acid chloride.
| Compound Name | (4R,5R)-3-benzyl-2,4,5-triphenyl-1,4-dihydroimidazol-3-ium-5-carboxylic acid chloride |
|---|---|
| PubChem CID | 44563948 |
| Molecular Formula | C29H25ClN2O2 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (4R,5R)-3-benzyl-2,4,5-triphenyl-1,4-dihydroimidazol-3-ium-5-carboxylic acid chloride |
| SMILES | O=C(O)[C@]1(c2ccccc2)NC(c2ccccc2)=[N+](Cc2ccccc2)[C@@H]1c1ccccc1.[Cl-] |
| InChI | InChI=1S/C29H24N2O2.ClH/c32-28(33)29(25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)31(21-22-13-5-1-6-14-22)27(30-29)24-17-9-3-10-18-24;/h1-20,26H,21H2,(H,32,33);1H/t26-,29-;/m1./s1 |
| InChIKey | AQTDJEWMBZNSJJ-OVWBULDYSA-N |
| XLogP | 1.97 |
| TPSA | 52.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|