C29H24N2O2 — CID 11669973
(4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid (PubChem CID 11669973) has the molecular formula C29H24N2O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid.
| Compound Name | (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 11669973 |
| Molecular Formula | C29H24N2O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid |
| SMILES | O=C(O)[C@]1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H24N2O2/c32-28(33)29(25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)31(21-22-13-5-1-6-14-22)27(30-29)24-17-9-3-10-18-24/h1-20,26H,21H2,(H,32,33)/t26-,29-/m1/s1 |
| InChIKey | SHAVOCVWHNDNMP-GGXMVOPNSA-N |
| XLogP | 5.67 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |