C30H26N2O2 — CID 135002298
(4S,5S)-3,5-dibenzyl-2,4-diphenyl-4H-imidazole-5-carboxylic acid (PubChem CID 135002298) has the molecular formula C30H26N2O2 and a molecular weight of 446.55 g/mol. Its IUPAC name is (4S,5S)-3,5-dibenzyl-2,4-diphenyl-4H-imidazole-5-carboxylic acid.
| Compound Name | (4S,5S)-3,5-dibenzyl-2,4-diphenyl-4H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 135002298 |
| Molecular Formula | C30H26N2O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (4S,5S)-3,5-dibenzyl-2,4-diphenyl-4H-imidazole-5-carboxylic acid |
| SMILES | O=C(O)[C@@]1(Cc2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H26N2O2/c33-29(34)30(21-23-13-5-1-6-14-23)27(25-17-9-3-10-18-25)32(22-24-15-7-2-8-16-24)28(31-30)26-19-11-4-12-20-26/h1-20,27H,21-22H2,(H,33,34)/t27-,30-/m0/s1 |
| InChIKey | QQCWEJPUTSNCHZ-FIBWVYCGSA-N |
| XLogP | 5.76 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |