C26H31ClN2O5S — CID 50943010
N-[(7S)-4-chloro-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]piperidine-1-carbothioamide (PubChem CID 50943010) has the molecular formula C26H31ClN2O5S and a molecular weight of 519.06 g/mol. Its IUPAC name is N-[(7S)-4-chloro-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]piperidine-1-carbothioamide.
| Compound Name | N-[(7S)-4-chloro-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 50943010 |
| Molecular Formula | C26H31ClN2O5S |
| Molecular Weight | 519.06 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | N-[(7S)-4-chloro-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]piperidine-1-carbothioamide |
| SMILES | COc1c(Cl)c2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(=S)N1CCCCC1)CC2 |
| InChI | InChI=1S/C26H31ClN2O5S/c1-31-20-11-9-15-17(14-19(20)30)18(28-26(35)29-12-6-5-7-13-29)10-8-16-21(15)23(32-2)25(34-4)24(33-3)22(16)27/h9,11,14,18H,5-8,10,12-13H2,1-4H3,(H,28,35)/t18-/m0/s1 |
| InChIKey | OTQNMXKCVXKJDG-SFHVURJKSA-N |
| XLogP | 4.75 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.06 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|