C27H25ClN2O8 — CID 50943084
N-[(7S)-4-chloro-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-nitrobenzamide (PubChem CID 50943084) has the molecular formula C27H25ClN2O8 and a molecular weight of 540.96 g/mol. Its IUPAC name is N-[(7S)-4-chloro-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-nitrobenzamide.
| Compound Name | N-[(7S)-4-chloro-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 50943084 |
| Molecular Formula | C27H25ClN2O8 |
| Molecular Weight | 540.96 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | N-[(7S)-4-chloro-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-nitrobenzamide |
| SMILES | COc1c(Cl)c2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(=O)c1cccc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C27H25ClN2O8/c1-35-21-11-9-16-18(13-20(21)31)19(29-27(32)14-6-5-7-15(12-14)30(33)34)10-8-17-22(16)24(36-2)26(38-4)25(37-3)23(17)28/h5-7,9,11-13,19H,8,10H2,1-4H3,(H,29,32)/t19-/m0/s1 |
| InChIKey | KEHWABAWQATSNO-IBGZPJMESA-N |
| XLogP | 4.73 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|