C27H33BrN2O5S — CID 50943472
1-[(7S)-4-bromo-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-cyclohexylthiourea (PubChem CID 50943472) has the molecular formula C27H33BrN2O5S and a molecular weight of 577.54 g/mol. Its IUPAC name is 1-[(7S)-4-bromo-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-cyclohexylthiourea.
| Compound Name | 1-[(7S)-4-bromo-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 50943472 |
| Molecular Formula | C27H33BrN2O5S |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 1-[(7S)-4-bromo-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-cyclohexylthiourea |
| SMILES | COc1c(Br)c2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(=S)NC1CCCCC1)CC2 |
| InChI | InChI=1S/C27H33BrN2O5S/c1-32-21-13-11-16-18(14-20(21)31)19(30-27(36)29-15-8-6-5-7-9-15)12-10-17-22(16)24(33-2)26(35-4)25(34-3)23(17)28/h11,13-15,19H,5-10,12H2,1-4H3,(H2,29,30,36)/t19-/m0/s1 |
| InChIKey | OKXXBCRLDHQECL-IBGZPJMESA-N |
| XLogP | 5.29 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|