C19H26N4O2 — CID 50958341
N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-(pentanoylamino)benzamide (PubChem CID 50958341) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-(pentanoylamino)benzamide.
| Compound Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-(pentanoylamino)benzamide |
|---|---|
| PubChem CID | 50958341 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-4-(pentanoylamino)benzamide |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)NCCc2c(C)n[nH]c2C)cc1 |
| InChI | InChI=1S/C19H26N4O2/c1-4-5-6-18(24)21-16-9-7-15(8-10-16)19(25)20-12-11-17-13(2)22-23-14(17)3/h7-10H,4-6,11-12H2,1-3H3,(H,20,25)(H,21,24)(H,22,23) |
| InChIKey | JROVVIKMDSAYJO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |