C14H16N6O6 — CID 5095960
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]ethyl]acetamide (PubChem CID 5095960) has the molecular formula C14H16N6O6 and a molecular weight of 364.32 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]ethyl]acetamide.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 5095960 |
| Molecular Formula | C14H16N6O6 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-[2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]ethyl]acetamide |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)NCCNC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C14H16N6O6/c21-9-1-3-13(25)19(17-9)7-11(23)15-5-6-16-12(24)8-20-14(26)4-2-10(22)18-20/h1-4H,5-8H2,(H,15,23)(H,16,24)(H,17,21)(H,18,22) |
| InChIKey | RJCZJAFMJCYDGM-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 167.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|