C19H23F2N3O2 — CID 50959870
2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-ethyl-N-[(3-prop-2-enoxyphenyl)methyl]acetamide (PubChem CID 50959870) has the molecular formula C19H23F2N3O2 and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-ethyl-N-[(3-prop-2-enoxyphenyl)methyl]acetamide.
| Compound Name | 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-ethyl-N-[(3-prop-2-enoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 50959870 |
| Molecular Formula | C19H23F2N3O2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-ethyl-N-[(3-prop-2-enoxyphenyl)methyl]acetamide |
| SMILES | C=CCOc1cccc(CN(CC)C(=O)Cn2nc(C(F)F)cc2C)c1 |
| InChI | InChI=1S/C19H23F2N3O2/c1-4-9-26-16-8-6-7-15(11-16)12-23(5-2)18(25)13-24-14(3)10-17(22-24)19(20)21/h4,6-8,10-11,19H,1,5,9,12-13H2,2-3H3 |
| InChIKey | YBLOEIUMCPEQJK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|