C20H18N4O4 — CID 50961243
methyl (3S)-2-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 50961243) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is methyl (3S)-2-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (3S)-2-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 50961243 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methyl (3S)-2-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)CN1Cc1nc(-c2ccco2)no1 |
| InChI | InChI=1S/C20H18N4O4/c1-26-20(25)16-9-13-12-5-2-3-6-14(12)21-15(13)10-24(16)11-18-22-19(23-28-18)17-7-4-8-27-17/h2-8,16,21H,9-11H2,1H3/t16-/m0/s1 |
| InChIKey | CVLIJIKQLDCZJM-INIZCTEOSA-N |
| XLogP | 2.91 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|