C18H32N4O3 — CID 50963814
1-[(3aR,6aR)-3a-(4-propyl-1,4-diazepane-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone (PubChem CID 50963814) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-[(3aR,6aR)-3a-(4-propyl-1,4-diazepane-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone.
| Compound Name | 1-[(3aR,6aR)-3a-(4-propyl-1,4-diazepane-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 50963814 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 1-[(3aR,6aR)-3a-(4-propyl-1,4-diazepane-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone |
| SMILES | CCCN1CCCN(C(=O)[C@@]23CNC[C@@H]2CN(C(=O)COC)C3)CC1 |
| InChI | InChI=1S/C18H32N4O3/c1-3-5-20-6-4-7-21(9-8-20)17(24)18-13-19-10-15(18)11-22(14-18)16(23)12-25-2/h15,19H,3-14H2,1-2H3/t15-,18-/m1/s1 |
| InChIKey | AIEAJPWMCBBWSN-CRAIPNDOSA-N |
| XLogP | -0.37 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |