C16H29N3O3 — CID 50952816
(3aR,6aR)-5-(2-methoxyacetyl)-N-methyl-N-(3-methylbutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50952816) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is (3aR,6aR)-5-(2-methoxyacetyl)-N-methyl-N-(3-methylbutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-5-(2-methoxyacetyl)-N-methyl-N-(3-methylbutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50952816 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (3aR,6aR)-5-(2-methoxyacetyl)-N-methyl-N-(3-methylbutyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | COCC(=O)N1C[C@H]2CNC[C@@]2(C(=O)N(C)CCC(C)C)C1 |
| InChI | InChI=1S/C16H29N3O3/c1-12(2)5-6-18(3)15(21)16-10-17-7-13(16)8-19(11-16)14(20)9-22-4/h12-13,17H,5-11H2,1-4H3/t13-,16-/m1/s1 |
| InChIKey | CCRCPLSUYIOOBV-CZUORRHYSA-N |
| XLogP | 0.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |