C17H27N7O — CID 50965848
N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50965848) has the molecular formula C17H27N7O and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50965848 |
| Molecular Formula | C17H27N7O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | O=C(NCCN1CCN(c2ncccn2)CC1)C12CNCC1CNC2 |
| InChI | InChI=1S/C17H27N7O/c25-15(17-12-18-10-14(17)11-19-13-17)20-4-5-23-6-8-24(9-7-23)16-21-2-1-3-22-16/h1-3,14,18-19H,4-13H2,(H,20,25) |
| InChIKey | JPZVHFZCPBDIAO-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |