C24H24N4O — CID 50966391
2-[[4-[5-(furan-2-yl)-4-phenylimidazol-1-yl]piperidin-1-yl]methyl]pyridine (PubChem CID 50966391) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[[4-[5-(furan-2-yl)-4-phenylimidazol-1-yl]piperidin-1-yl]methyl]pyridine.
| Compound Name | 2-[[4-[5-(furan-2-yl)-4-phenylimidazol-1-yl]piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 50966391 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[[4-[5-(furan-2-yl)-4-phenylimidazol-1-yl]piperidin-1-yl]methyl]pyridine |
| SMILES | c1ccc(-c2ncn(C3CCN(Cc4ccccn4)CC3)c2-c2ccco2)cc1 |
| InChI | InChI=1S/C24H24N4O/c1-2-7-19(8-3-1)23-24(22-10-6-16-29-22)28(18-26-23)21-11-14-27(15-12-21)17-20-9-4-5-13-25-20/h1-10,13,16,18,21H,11-12,14-15,17H2 |
| InChIKey | FTSDHGLEEJWQBI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |