C16H18N4S — CID 50968556
N-methyl-N-[(3-methylthiophen-2-yl)methyl]-1-(1-pyrimidin-2-ylpyrrol-2-yl)methanamine (PubChem CID 50968556) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is N-methyl-N-[(3-methylthiophen-2-yl)methyl]-1-(1-pyrimidin-2-ylpyrrol-2-yl)methanamine.
| Compound Name | N-methyl-N-[(3-methylthiophen-2-yl)methyl]-1-(1-pyrimidin-2-ylpyrrol-2-yl)methanamine |
|---|---|
| PubChem CID | 50968556 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-methyl-N-[(3-methylthiophen-2-yl)methyl]-1-(1-pyrimidin-2-ylpyrrol-2-yl)methanamine |
| SMILES | Cc1ccsc1CN(C)Cc1cccn1-c1ncccn1 |
| InChI | InChI=1S/C16H18N4S/c1-13-6-10-21-15(13)12-19(2)11-14-5-3-9-20(14)16-17-7-4-8-18-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | XWAHEUIHPAGPBG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |