C20H31N3O3 — CID 50968737
N'-(2,5-dimethylphenyl)-N-[3-[2-(hydroxymethyl)piperidin-1-yl]propyl]propanediamide (PubChem CID 50968737) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is N'-(2,5-dimethylphenyl)-N-[3-[2-(hydroxymethyl)piperidin-1-yl]propyl]propanediamide.
| Compound Name | N'-(2,5-dimethylphenyl)-N-[3-[2-(hydroxymethyl)piperidin-1-yl]propyl]propanediamide |
|---|---|
| PubChem CID | 50968737 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | N'-(2,5-dimethylphenyl)-N-[3-[2-(hydroxymethyl)piperidin-1-yl]propyl]propanediamide |
| SMILES | Cc1ccc(C)c(NC(=O)CC(=O)NCCCN2CCCCC2CO)c1 |
| InChI | InChI=1S/C20H31N3O3/c1-15-7-8-16(2)18(12-15)22-20(26)13-19(25)21-9-5-11-23-10-4-3-6-17(23)14-24/h7-8,12,17,24H,3-6,9-11,13-14H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | NBWNNZVCYBMXCT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|