C18H24N4 — CID 50971160
N-[(1-methylindol-3-yl)methyl]-N-[(1-methylpyrazol-4-yl)methyl]propan-2-amine (PubChem CID 50971160) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-[(1-methylindol-3-yl)methyl]-N-[(1-methylpyrazol-4-yl)methyl]propan-2-amine.
| Compound Name | N-[(1-methylindol-3-yl)methyl]-N-[(1-methylpyrazol-4-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 50971160 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N-[(1-methylindol-3-yl)methyl]-N-[(1-methylpyrazol-4-yl)methyl]propan-2-amine |
| SMILES | CC(C)N(Cc1cnn(C)c1)Cc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C18H24N4/c1-14(2)22(11-15-9-19-21(4)10-15)13-16-12-20(3)18-8-6-5-7-17(16)18/h5-10,12,14H,11,13H2,1-4H3 |
| InChIKey | VAGNTKFVAPUSND-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |