C21H24N2O4 — CID 50973682
[(1R,3S,3aS,6aR)-3-(7-methoxy-1,3-benzodioxol-5-yl)-5-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-1-yl]methanol (PubChem CID 50973682) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is [(1R,3S,3aS,6aR)-3-(7-methoxy-1,3-benzodioxol-5-yl)-5-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-1-yl]methanol.
| Compound Name | [(1R,3S,3aS,6aR)-3-(7-methoxy-1,3-benzodioxol-5-yl)-5-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-1-yl]methanol |
|---|---|
| PubChem CID | 50973682 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [(1R,3S,3aS,6aR)-3-(7-methoxy-1,3-benzodioxol-5-yl)-5-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-1-yl]methanol |
| SMILES | COc1cc([C@H]2N[C@@H](CO)[C@H]3CN(c4ccccc4)C[C@H]32)cc2c1OCO2 |
| InChI | InChI=1S/C21H24N2O4/c1-25-18-7-13(8-19-21(18)27-12-26-19)20-16-10-23(14-5-3-2-4-6-14)9-15(16)17(11-24)22-20/h2-8,15-17,20,22,24H,9-12H2,1H3/t15-,16+,17-,20+/m0/s1 |
| InChIKey | ADGDKMSHHQKVQV-PFRQMTDMSA-N |
| XLogP | 2.18 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |