C21H26N2O3 — CID 133119149
2-[(1S,3R,3aR,6aS)-5-benzyl-1-(hydroxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl]-6-methoxyphenol (PubChem CID 133119149) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[(1S,3R,3aR,6aS)-5-benzyl-1-(hydroxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl]-6-methoxyphenol.
| Compound Name | 2-[(1S,3R,3aR,6aS)-5-benzyl-1-(hydroxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl]-6-methoxyphenol |
|---|---|
| PubChem CID | 133119149 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-[(1S,3R,3aR,6aS)-5-benzyl-1-(hydroxymethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-3-yl]-6-methoxyphenol |
| SMILES | COc1cccc([C@@H]2N[C@H](CO)[C@@H]3CN(Cc4ccccc4)C[C@@H]32)c1O |
| InChI | InChI=1S/C21H26N2O3/c1-26-19-9-5-8-15(21(19)25)20-17-12-23(10-14-6-3-2-4-7-14)11-16(17)18(13-24)22-20/h2-9,16-18,20,22,24-25H,10-13H2,1H3/t16-,17+,18-,20+/m1/s1 |
| InChIKey | HRQVLOKKBVHXGJ-RMJJICAUSA-N |
| XLogP | 2.15 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|