About methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate
methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate (PubChem CID 50974964) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate.
Molecular Properties
| Compound Name | methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate |
| PubChem CID | 50974964 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate |
| SMILES | COC(=O)CCCc1nc(C2CC2)n[nH]1 |
| InChI | InChI=1S/C10H15N3O2/c1-15-9(14)4-2-3-8-11-10(13-12-8)7-5-6-7/h7H,2-6H2,1H3,(H,11,12,13) |
| InChIKey | LEOBBQVNLYEUCQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate?
The IUPAC name of methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate (CID 50974964) is methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate.
What is the SMILES notation for methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate?
The canonical SMILES for methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate is COC(=O)CCCc1nc(C2CC2)n[nH]1.
What is the InChIKey of methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate?
The InChIKey is LEOBBQVNLYEUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-15-9(14)4-2-3-8-11-10(13-12-8)7-5-6-7/h7H,2-6H2,1H3,(H,11,12,13).
What are the key properties of methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate?
methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate has a molecular weight of 209.25 g/mol, XLogP of 1.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)butanoate is sourced from PubChem (CID 50974964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).