C19H23N3O2 — CID 50978433
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 50978433) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 50978433 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)c1cnc2ccccn2c1=O |
| InChI | InChI=1S/C19H23N3O2/c1-14(2)7-6-8-15(3)10-11-20-18(23)16-13-21-17-9-4-5-12-22(17)19(16)24/h4-5,7,9-10,12-13H,6,8,11H2,1-3H3,(H,20,23)/b15-10+ |
| InChIKey | AJHOBSNQAXCVLP-XNTDXEJSSA-N |
| XLogP | 3.12 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|