C19H18N4OS — CID 50978509
5-(1H-imidazol-2-yl)-1-(2-methoxy-2-thiophen-2-ylethyl)-4-phenylimidazole (PubChem CID 50978509) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 5-(1H-imidazol-2-yl)-1-(2-methoxy-2-thiophen-2-ylethyl)-4-phenylimidazole.
| Compound Name | 5-(1H-imidazol-2-yl)-1-(2-methoxy-2-thiophen-2-ylethyl)-4-phenylimidazole |
|---|---|
| PubChem CID | 50978509 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 5-(1H-imidazol-2-yl)-1-(2-methoxy-2-thiophen-2-ylethyl)-4-phenylimidazole |
| SMILES | COC(Cn1cnc(-c2ccccc2)c1-c1ncc[nH]1)c1cccs1 |
| InChI | InChI=1S/C19H18N4OS/c1-24-15(16-8-5-11-25-16)12-23-13-22-17(14-6-3-2-4-7-14)18(23)19-20-9-10-21-19/h2-11,13,15H,12H2,1H3,(H,20,21) |
| InChIKey | MLCXKFUHYPNVKC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |