C21H25N5OS — CID 50979100
(1S,9R)-11-[2-(2-aminoethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 50979100) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is (1S,9R)-11-[2-(2-aminoethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9R)-11-[2-(2-aminoethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 50979100 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (1S,9R)-11-[2-(2-aminoethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1sc2nc(CCN)nc(N3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)c2c1C |
| InChI | InChI=1S/C21H25N5OS/c1-12-13(2)28-21-19(12)20(23-17(24-21)6-7-22)25-9-14-8-15(11-25)16-4-3-5-18(27)26(16)10-14/h3-5,14-15H,6-11,22H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | WQDUBULFFHHQNX-CABCVRRESA-N |
| XLogP | 2.59 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |