C20H19N7O2S — CID 74455043
11-[6-(thiophen-2-ylmethylamino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 74455043) has the molecular formula C20H19N7O2S and a molecular weight of 421.49 g/mol. Its IUPAC name is 11-[6-(thiophen-2-ylmethylamino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 11-[6-(thiophen-2-ylmethylamino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 74455043 |
| Molecular Formula | C20H19N7O2S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 11-[6-(thiophen-2-ylmethylamino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cccc2n1CC1CC2CN(c2nc3nonc3nc2NCc2cccs2)C1 |
| InChI | InChI=1S/C20H19N7O2S/c28-16-5-1-4-15-13-7-12(10-27(15)16)9-26(11-13)20-19(21-8-14-3-2-6-30-14)22-17-18(23-20)25-29-24-17/h1-6,12-13H,7-11H2,(H,21,22,24) |
| InChIKey | KFDHRPYGGZQVHS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |