C19H19ClN6O2 — CID 7273110
(1S,9S)-11-[4-chloro-6-(furan-2-ylmethylamino)-1,3,5-triazin-2-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 7273110) has the molecular formula C19H19ClN6O2 and a molecular weight of 398.85 g/mol. Its IUPAC name is (1S,9S)-11-[4-chloro-6-(furan-2-ylmethylamino)-1,3,5-triazin-2-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9S)-11-[4-chloro-6-(furan-2-ylmethylamino)-1,3,5-triazin-2-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 7273110 |
| Molecular Formula | C19H19ClN6O2 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (1S,9S)-11-[4-chloro-6-(furan-2-ylmethylamino)-1,3,5-triazin-2-yl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cccc2n1C[C@H]1C[C@H]2CN(c2nc(Cl)nc(NCc3ccco3)n2)C1 |
| InChI | InChI=1S/C19H19ClN6O2/c20-17-22-18(21-8-14-3-2-6-28-14)24-19(23-17)25-9-12-7-13(11-25)15-4-1-5-16(27)26(15)10-12/h1-6,12-13H,7-11H2,(H,21,22,23,24)/t12-,13-/m0/s1 |
| InChIKey | HHWFEUZQCJPBKX-STQMWFEESA-N |
| XLogP | 2.52 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |