C23H26N4O5 — CID 3747356
5-(furan-2-ylmethyl)-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 3747356) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 5-(furan-2-ylmethyl)-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(furan-2-ylmethyl)-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3747356 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 5-(furan-2-ylmethyl)-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C(Cc2ccco2)(CN2CC3CC(C2)c2cccc(=O)n2C3)C1=O |
| InChI | InChI=1S/C23H26N4O5/c1-24-20(29)23(10-17-5-4-8-32-17,21(30)25(2)22(24)31)14-26-11-15-9-16(13-26)18-6-3-7-19(28)27(18)12-15/h3-8,15-16H,9-14H2,1-2H3 |
| InChIKey | DBRDHYQXMNPBRH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 96.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|