C25H26Cl2N4O4 — CID 163013874
5-[(2,6-dichlorophenyl)methyl]-1,3-dimethyl-5-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 163013874) has the molecular formula C25H26Cl2N4O4 and a molecular weight of 517.41 g/mol. Its IUPAC name is 5-[(2,6-dichlorophenyl)methyl]-1,3-dimethyl-5-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2,6-dichlorophenyl)methyl]-1,3-dimethyl-5-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 163013874 |
| Molecular Formula | C25H26Cl2N4O4 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 5-[(2,6-dichlorophenyl)methyl]-1,3-dimethyl-5-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C(Cc2c(Cl)cccc2Cl)(CN2C[C@H]3C[C@H](C2)c2cccc(=O)n2C3)C1=O |
| InChI | InChI=1S/C25H26Cl2N4O4/c1-28-22(33)25(23(34)29(2)24(28)35,10-17-18(26)5-3-6-19(17)27)14-30-11-15-9-16(13-30)20-7-4-8-21(32)31(20)12-15/h3-8,15-16H,9-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | HSWLJIAFHIOTFA-HZPDHXFCSA-N |
| XLogP | 2.85 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|