C28H31N5O4 — CID 98135179
1,3-dimethyl-5-[(1-methylindol-3-yl)methyl]-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 98135179) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(1-methylindol-3-yl)methyl]-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[(1-methylindol-3-yl)methyl]-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 98135179 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1,3-dimethyl-5-[(1-methylindol-3-yl)methyl]-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C(Cc2cn(C)c3ccccc23)(CN2C[C@@H]3C[C@@H](C2)c2cccc(=O)n2C3)C1=O |
| InChI | InChI=1S/C28H31N5O4/c1-29-15-20(21-7-4-5-8-23(21)29)12-28(25(35)30(2)27(37)31(3)26(28)36)17-32-13-18-11-19(16-32)22-9-6-10-24(34)33(22)14-18/h4-10,15,18-19H,11-14,16-17H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | IYOUFVAUJIPHDU-OALUTQOASA-N |
| XLogP | 2.04 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|