C30H32N4O4S — CID 3724859
5-[(4-methoxynaphthalen-1-yl)methyl]-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 3724859) has the molecular formula C30H32N4O4S and a molecular weight of 544.68 g/mol. Its IUPAC name is 5-[(4-methoxynaphthalen-1-yl)methyl]-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(4-methoxynaphthalen-1-yl)methyl]-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 3724859 |
| Molecular Formula | C30H32N4O4S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 5-[(4-methoxynaphthalen-1-yl)methyl]-1,3-dimethyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc(CC2(CN3CC4CC(C3)c3cccc(=O)n3C4)C(=O)N(C)C(=S)N(C)C2=O)c2ccccc12 |
| InChI | InChI=1S/C30H32N4O4S/c1-31-27(36)30(28(37)32(2)29(31)39,14-20-11-12-25(38-3)23-8-5-4-7-22(20)23)18-33-15-19-13-21(17-33)24-9-6-10-26(35)34(24)16-19/h4-12,19,21H,13-18H2,1-3H3 |
| InChIKey | SIXJIUNHTBIAFX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|