C31H32N4O5 — CID 131664834
1-benzyl-5-[(2-methoxyphenyl)methyl]-5-[[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 131664834) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is 1-benzyl-5-[(2-methoxyphenyl)methyl]-5-[[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-benzyl-5-[(2-methoxyphenyl)methyl]-5-[[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 131664834 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 1-benzyl-5-[(2-methoxyphenyl)methyl]-5-[[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccccc1CC1(CN2CC3C[C@@H](C2)c2cccc(=O)n2C3)C(=O)NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C31H32N4O5/c1-40-26-12-6-5-10-23(26)15-31(28(37)32-30(39)35(29(31)38)17-21-8-3-2-4-9-21)20-33-16-22-14-24(19-33)25-11-7-13-27(36)34(25)18-22/h2-13,22,24H,14-20H2,1H3,(H,32,37,39)/t22?,24-,31?/m0/s1 |
| InChIKey | HYQPARXNRKQMOW-AKFGGTECSA-N |
| XLogP | 2.78 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|