C31H32N4O6 — CID 163071288
(5S)-1-(4-methoxyphenyl)-5-[(4-methoxyphenyl)methyl]-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 163071288) has the molecular formula C31H32N4O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is (5S)-1-(4-methoxyphenyl)-5-[(4-methoxyphenyl)methyl]-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-1-(4-methoxyphenyl)-5-[(4-methoxyphenyl)methyl]-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 163071288 |
| Molecular Formula | C31H32N4O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | (5S)-1-(4-methoxyphenyl)-5-[(4-methoxyphenyl)methyl]-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(C[C@]2(CN3C[C@@H]4C[C@@H](C3)c3cccc(=O)n3C4)C(=O)NC(=O)N(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C31H32N4O6/c1-40-24-10-6-20(7-11-24)15-31(19-33-16-21-14-22(18-33)26-4-3-5-27(36)34(26)17-21)28(37)32-30(39)35(29(31)38)23-8-12-25(41-2)13-9-23/h3-13,21-22H,14-19H2,1-2H3,(H,32,37,39)/t21-,22-,31-/m0/s1 |
| InChIKey | CZHXWJUFFYDJKV-CYYCZYJVSA-N |
| XLogP | 2.80 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|