C27H26N4O4S — CID 163072939
(5R)-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1-phenyl-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 163072939) has the molecular formula C27H26N4O4S and a molecular weight of 502.60 g/mol. Its IUPAC name is (5R)-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1-phenyl-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1-phenyl-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 163072939 |
| Molecular Formula | C27H26N4O4S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (5R)-5-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1-phenyl-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)[C@@](Cc2cccs2)(CN2C[C@@H]3C[C@@H](C2)c2cccc(=O)n2C3)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H26N4O4S/c32-23-10-4-9-22-19-12-18(15-30(22)23)14-29(16-19)17-27(13-21-8-5-11-36-21)24(33)28-26(35)31(25(27)34)20-6-2-1-3-7-20/h1-11,18-19H,12-17H2,(H,28,33,35)/t18-,19-,27+/m0/s1 |
| InChIKey | IXSOGNQHHMUEMT-RWYJCYHVSA-N |
| XLogP | 2.84 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|