C32H34N4O5 — CID 154808585
1-(4-ethoxyphenyl)-5-[(4-methylphenyl)methyl]-5-[[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 154808585) has the molecular formula C32H34N4O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-5-[(4-methylphenyl)methyl]-5-[[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-ethoxyphenyl)-5-[(4-methylphenyl)methyl]-5-[[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 154808585 |
| Molecular Formula | C32H34N4O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 1-(4-ethoxyphenyl)-5-[(4-methylphenyl)methyl]-5-[[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccc(N2C(=O)NC(=O)C(Cc3ccc(C)cc3)(CN3CC4C[C@@H](C3)c3cccc(=O)n3C4)C2=O)cc1 |
| InChI | InChI=1S/C32H34N4O5/c1-3-41-26-13-11-25(12-14-26)36-30(39)32(29(38)33-31(36)40,16-22-9-7-21(2)8-10-22)20-34-17-23-15-24(19-34)27-5-4-6-28(37)35(27)18-23/h4-14,23-24H,3,15-20H2,1-2H3,(H,33,38,40)/t23?,24-,32?/m0/s1 |
| InChIKey | STOQBZCABIRZJT-ZGPQHVOCSA-N |
| XLogP | 3.49 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|