C33H36N4O7 — CID 95370690
(5S)-5-[(2,4-dimethoxyphenyl)methyl]-1-(2-ethoxyphenyl)-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 95370690) has the molecular formula C33H36N4O7 and a molecular weight of 600.67 g/mol. Its IUPAC name is (5S)-5-[(2,4-dimethoxyphenyl)methyl]-1-(2-ethoxyphenyl)-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-5-[(2,4-dimethoxyphenyl)methyl]-1-(2-ethoxyphenyl)-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 95370690 |
| Molecular Formula | C33H36N4O7 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | (5S)-5-[(2,4-dimethoxyphenyl)methyl]-1-(2-ethoxyphenyl)-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccccc1N1C(=O)NC(=O)[C@](Cc2ccc(OC)cc2OC)(CN2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)C1=O |
| InChI | InChI=1S/C33H36N4O7/c1-4-44-27-10-6-5-8-26(27)37-31(40)33(30(39)34-32(37)41,16-22-12-13-24(42-2)15-28(22)43-3)20-35-17-21-14-23(19-35)25-9-7-11-29(38)36(25)18-21/h5-13,15,21,23H,4,14,16-20H2,1-3H3,(H,34,39,41)/t21-,23+,33+/m1/s1 |
| InChIKey | PEVSCFOOQCXDTB-BRGUJNTOSA-N |
| XLogP | 3.20 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|