C23H26N4O4S — CID 50904069
1,3-dimethyl-5-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-5-(thiophen-3-ylmethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 50904069) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-5-(thiophen-3-ylmethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-5-(thiophen-3-ylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50904069 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1,3-dimethyl-5-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-5-(thiophen-3-ylmethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C(Cc2ccsc2)(CN2C[C@H]3C[C@H](C2)c2cccc(=O)n2C3)C1=O |
| InChI | InChI=1S/C23H26N4O4S/c1-24-20(29)23(9-15-6-7-32-13-15,21(30)25(2)22(24)31)14-26-10-16-8-17(12-26)18-4-3-5-19(28)27(18)11-16/h3-7,13,16-17H,8-12,14H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | YNVVPCSYJMWAJB-IAGOWNOFSA-N |
| XLogP | 1.61 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|